C17H22N6O — CID 67544765
1-[(9-benzyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl)amino]propan-2-ol (PubChem CID 67544765) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[(9-benzyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl)amino]propan-2-ol.
| Compound Name | 1-[(9-benzyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 67544765 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[(9-benzyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl)amino]propan-2-ol |
| SMILES | CC(O)CNc1nc2c3c(n1)N(Cc1ccccc1)CCC3NN2 |
| InChI | InChI=1S/C17H22N6O/c1-11(24)9-18-17-19-15-14-13(21-22-15)7-8-23(16(14)20-17)10-12-5-3-2-4-6-12/h2-6,11,13,21,24H,7-10H2,1H3,(H2,18,19,20,22) |
| InChIKey | RXRCTYKYYIVGBP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |