C26H29N7O — CID 67543959
N,9-dibenzyl-6-(cyclobutylamino)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-11-carboxamide (PubChem CID 67543959) has the molecular formula C26H29N7O and a molecular weight of 455.57 g/mol. Its IUPAC name is N,9-dibenzyl-6-(cyclobutylamino)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-11-carboxamide.
| Compound Name | N,9-dibenzyl-6-(cyclobutylamino)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 67543959 |
| Molecular Formula | C26H29N7O |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | N,9-dibenzyl-6-(cyclobutylamino)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-11-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CN(Cc2ccccc2)c2nc(NC3CCC3)nc3c2C1NN3 |
| InChI | InChI=1S/C26H29N7O/c34-25(27-14-17-8-3-1-4-9-17)20-16-33(15-18-10-5-2-6-11-18)24-21-22(20)31-32-23(21)29-26(30-24)28-19-12-7-13-19/h1-6,8-11,19-20,22,31H,7,12-16H2,(H,27,34)(H2,28,29,30,32) |
| InChIKey | RKRDUCXSCFEQFM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |