C27H25N7O2 — CID 59506395
N,9-dibenzyl-6-(furan-2-ylmethylamino)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraene-11-carboxamide (PubChem CID 59506395) has the molecular formula C27H25N7O2 and a molecular weight of 479.54 g/mol. Its IUPAC name is N,9-dibenzyl-6-(furan-2-ylmethylamino)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraene-11-carboxamide.
| Compound Name | N,9-dibenzyl-6-(furan-2-ylmethylamino)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 59506395 |
| Molecular Formula | C27H25N7O2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N,9-dibenzyl-6-(furan-2-ylmethylamino)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraene-11-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CN(Cc2ccccc2)c2nc(NCc3ccco3)nc3n[nH]c1c23 |
| InChI | InChI=1S/C27H25N7O2/c35-26(28-14-18-8-3-1-4-9-18)21-17-34(16-19-10-5-2-6-11-19)25-22-23(21)32-33-24(22)30-27(31-25)29-15-20-12-7-13-36-20/h1-13,21H,14-17H2,(H,28,35)(H2,29,30,31,32,33) |
| InChIKey | CMJAJOYOQDBDCK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |