C25H27N3O3 — CID 46065319
1-N-benzyl-3-N-(furan-2-ylmethyl)-5-phenylpiperidine-1,3-dicarboxamide (PubChem CID 46065319) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-N-benzyl-3-N-(furan-2-ylmethyl)-5-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-benzyl-3-N-(furan-2-ylmethyl)-5-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46065319 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 1-N-benzyl-3-N-(furan-2-ylmethyl)-5-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccco1)C1CC(c2ccccc2)CN(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C25H27N3O3/c29-24(26-16-23-12-7-13-31-23)22-14-21(20-10-5-2-6-11-20)17-28(18-22)25(30)27-15-19-8-3-1-4-9-19/h1-13,21-22H,14-18H2,(H,26,29)(H,27,30) |
| InChIKey | OCRMVRNVEHDDLT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |