C24H31N3O4 — CID 46065367
3-N-benzyl-5-(3,4-dimethoxyphenyl)-1-N-ethylpiperidine-1,3-dicarboxamide (PubChem CID 46065367) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-N-benzyl-5-(3,4-dimethoxyphenyl)-1-N-ethylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-benzyl-5-(3,4-dimethoxyphenyl)-1-N-ethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46065367 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 3-N-benzyl-5-(3,4-dimethoxyphenyl)-1-N-ethylpiperidine-1,3-dicarboxamide |
| SMILES | CCNC(=O)N1CC(C(=O)NCc2ccccc2)CC(c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C24H31N3O4/c1-4-25-24(29)27-15-19(18-10-11-21(30-2)22(13-18)31-3)12-20(16-27)23(28)26-14-17-8-6-5-7-9-17/h5-11,13,19-20H,4,12,14-16H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | RDJURYHMIPUMQZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |