C27H37N3O4 — CID 42865453
1-N-butyl-5-(3,4-dimethoxyphenyl)-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide (PubChem CID 42865453) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is 1-N-butyl-5-(3,4-dimethoxyphenyl)-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-5-(3,4-dimethoxyphenyl)-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 42865453 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 1-N-butyl-5-(3,4-dimethoxyphenyl)-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1CC(C(=O)NCCc2ccccc2)CC(c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C27H37N3O4/c1-4-5-14-29-27(32)30-18-22(21-11-12-24(33-2)25(17-21)34-3)16-23(19-30)26(31)28-15-13-20-9-7-6-8-10-20/h6-12,17,22-23H,4-5,13-16,18-19H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | FQPMDXGPWHRENN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|