C28H30N2O3 — CID 92994736
(3S,5R)-1-(4-methoxybenzoyl)-5-phenyl-N-(2-phenylethyl)piperidine-3-carboxamide (PubChem CID 92994736) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is (3S,5R)-1-(4-methoxybenzoyl)-5-phenyl-N-(2-phenylethyl)piperidine-3-carboxamide.
| Compound Name | (3S,5R)-1-(4-methoxybenzoyl)-5-phenyl-N-(2-phenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92994736 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (3S,5R)-1-(4-methoxybenzoyl)-5-phenyl-N-(2-phenylethyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N2C[C@@H](C(=O)NCCc3ccccc3)C[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C28H30N2O3/c1-33-26-14-12-23(13-15-26)28(32)30-19-24(22-10-6-3-7-11-22)18-25(20-30)27(31)29-17-16-21-8-4-2-5-9-21/h2-15,24-25H,16-20H2,1H3,(H,29,31)/t24-,25-/m0/s1 |
| InChIKey | HYIPYNQBRKWZPH-DQEYMECFSA-N |
| XLogP | 4.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |