C28H31N3O3 — CID 92995542
(3R,5R)-1-N-(3-methoxyphenyl)-5-phenyl-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide (PubChem CID 92995542) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is (3R,5R)-1-N-(3-methoxyphenyl)-5-phenyl-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R,5R)-1-N-(3-methoxyphenyl)-5-phenyl-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 92995542 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (3R,5R)-1-N-(3-methoxyphenyl)-5-phenyl-3-N-(2-phenylethyl)piperidine-1,3-dicarboxamide |
| SMILES | COc1cccc(NC(=O)N2C[C@H](C(=O)NCCc3ccccc3)C[C@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C28H31N3O3/c1-34-26-14-8-13-25(18-26)30-28(33)31-19-23(22-11-6-3-7-12-22)17-24(20-31)27(32)29-16-15-21-9-4-2-5-10-21/h2-14,18,23-24H,15-17,19-20H2,1H3,(H,29,32)(H,30,33)/t23-,24+/m0/s1 |
| InChIKey | PNTRPADBNWNYCN-BJKOFHAPSA-N |
| XLogP | 4.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |