C24H29N3O3 — CID 46065416
1-N-(3-methoxyphenyl)-5-(3-methylphenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide (PubChem CID 46065416) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-N-(3-methoxyphenyl)-5-(3-methylphenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(3-methoxyphenyl)-5-(3-methylphenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46065416 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-N-(3-methoxyphenyl)-5-(3-methylphenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)C1CC(c2cccc(C)c2)CN(C(=O)Nc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C24H29N3O3/c1-4-11-25-23(28)20-13-19(18-8-5-7-17(2)12-18)15-27(16-20)24(29)26-21-9-6-10-22(14-21)30-3/h4-10,12,14,19-20H,1,11,13,15-16H2,2-3H3,(H,25,28)(H,26,29) |
| InChIKey | FTDPXIPMRXOONC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|