C28H30N2O5 — CID 42868408
N-(2,4-dimethoxyphenyl)-1-(4-methoxybenzoyl)-5-phenylpiperidine-3-carboxamide (PubChem CID 42868408) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-1-(4-methoxybenzoyl)-5-phenylpiperidine-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-1-(4-methoxybenzoyl)-5-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42868408 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-1-(4-methoxybenzoyl)-5-phenylpiperidine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N2CC(C(=O)Nc3ccc(OC)cc3OC)CC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C28H30N2O5/c1-33-23-11-9-20(10-12-23)28(32)30-17-21(19-7-5-4-6-8-19)15-22(18-30)27(31)29-25-14-13-24(34-2)16-26(25)35-3/h4-14,16,21-22H,15,17-18H2,1-3H3,(H,29,31) |
| InChIKey | HPJJPFLAIQBWOS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |