C27H27FN2O4 — CID 42868424
N-(3,5-dimethoxyphenyl)-1-(3-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide (PubChem CID 42868424) has the molecular formula C27H27FN2O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-(3-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-(3-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42868424 |
| Molecular Formula | C27H27FN2O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-(3-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2CC(c3ccccc3)CN(C(=O)c3cccc(F)c3)C2)cc(OC)c1 |
| InChI | InChI=1S/C27H27FN2O4/c1-33-24-13-23(14-25(15-24)34-2)29-26(31)21-11-20(18-7-4-3-5-8-18)16-30(17-21)27(32)19-9-6-10-22(28)12-19/h3-10,12-15,20-21H,11,16-17H2,1-2H3,(H,29,31) |
| InChIKey | GEERAFSWNTWDCL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |