C22H23FN2O2 — CID 92994693
(3R,5S)-N-cyclopropyl-1-(4-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide (PubChem CID 92994693) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is (3R,5S)-N-cyclopropyl-1-(4-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide.
| Compound Name | (3R,5S)-N-cyclopropyl-1-(4-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92994693 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (3R,5S)-N-cyclopropyl-1-(4-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CC1)[C@@H]1C[C@@H](c2ccccc2)CN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H23FN2O2/c23-19-8-6-16(7-9-19)22(27)25-13-17(15-4-2-1-3-5-15)12-18(14-25)21(26)24-20-10-11-20/h1-9,17-18,20H,10-14H2,(H,24,26)/t17-,18-/m1/s1 |
| InChIKey | JIWBLXYDJNMWJW-QZTJIDSGSA-N |
| XLogP | 3.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |