C25H22ClFN2O2 — CID 42868400
N-(4-chlorophenyl)-1-(4-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide (PubChem CID 42868400) has the molecular formula C25H22ClFN2O2 and a molecular weight of 436.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(4-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1-(4-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42868400 |
| Molecular Formula | C25H22ClFN2O2 |
| Molecular Weight | 436.91 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-(4-chlorophenyl)-1-(4-fluorobenzoyl)-5-phenylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1CC(c2ccccc2)CN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H22ClFN2O2/c26-21-8-12-23(13-9-21)28-24(30)20-14-19(17-4-2-1-3-5-17)15-29(16-20)25(31)18-6-10-22(27)11-7-18/h1-13,19-20H,14-16H2,(H,28,30) |
| InChIKey | KZQNBVWSTUFQPU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |