C23H36N4O2 — CID 92995666
(3R,5R)-1-N-butyl-5-phenyl-3-N-(2-pyrrolidin-1-ylethyl)piperidine-1,3-dicarboxamide (PubChem CID 92995666) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is (3R,5R)-1-N-butyl-5-phenyl-3-N-(2-pyrrolidin-1-ylethyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R,5R)-1-N-butyl-5-phenyl-3-N-(2-pyrrolidin-1-ylethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 92995666 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (3R,5R)-1-N-butyl-5-phenyl-3-N-(2-pyrrolidin-1-ylethyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1C[C@H](C(=O)NCCN2CCCC2)C[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H36N4O2/c1-2-3-11-25-23(29)27-17-20(19-9-5-4-6-10-19)16-21(18-27)22(28)24-12-15-26-13-7-8-14-26/h4-6,9-10,20-21H,2-3,7-8,11-18H2,1H3,(H,24,28)(H,25,29)/t20-,21+/m0/s1 |
| InChIKey | HOCZJKRAVBLSFU-LEWJYISDSA-N |
| XLogP | 2.81 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|