C20H32N4O2 — CID 121495919
4-(2-hydroxyethyl)-N-[2-(3-phenylpiperidin-1-yl)ethyl]piperazine-1-carboxamide (PubChem CID 121495919) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-N-[2-(3-phenylpiperidin-1-yl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-hydroxyethyl)-N-[2-(3-phenylpiperidin-1-yl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 121495919 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 4-(2-hydroxyethyl)-N-[2-(3-phenylpiperidin-1-yl)ethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCN1CCCC(c2ccccc2)C1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C20H32N4O2/c25-16-15-22-11-13-24(14-12-22)20(26)21-8-10-23-9-4-7-19(17-23)18-5-2-1-3-6-18/h1-3,5-6,19,25H,4,7-17H2,(H,21,26) |
| InChIKey | JLFYPOIWKKBVQP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |