C27H36FN3O3 — CID 93000799
(3R,5S)-1-N-butyl-5-(4-fluoro-3-methylphenyl)-3-N-[2-(2-methoxyphenyl)ethyl]piperidine-1,3-dicarboxamide (PubChem CID 93000799) has the molecular formula C27H36FN3O3 and a molecular weight of 469.60 g/mol. Its IUPAC name is (3R,5S)-1-N-butyl-5-(4-fluoro-3-methylphenyl)-3-N-[2-(2-methoxyphenyl)ethyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R,5S)-1-N-butyl-5-(4-fluoro-3-methylphenyl)-3-N-[2-(2-methoxyphenyl)ethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93000799 |
| Molecular Formula | C27H36FN3O3 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (3R,5S)-1-N-butyl-5-(4-fluoro-3-methylphenyl)-3-N-[2-(2-methoxyphenyl)ethyl]piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1C[C@H](C(=O)NCCc2ccccc2OC)C[C@@H](c2ccc(F)c(C)c2)C1 |
| InChI | InChI=1S/C27H36FN3O3/c1-4-5-13-30-27(33)31-17-22(21-10-11-24(28)19(2)15-21)16-23(18-31)26(32)29-14-12-20-8-6-7-9-25(20)34-3/h6-11,15,22-23H,4-5,12-14,16-18H2,1-3H3,(H,29,32)(H,30,33)/t22-,23-/m1/s1 |
| InChIKey | IPHYJFGZGWEFDY-DHIUTWEWSA-N |
| XLogP | 4.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|