C25H31FN2O2 — CID 42869827
5-(4-fluoro-3-methylphenyl)-N-[2-(2-methoxyphenyl)ethyl]-1-prop-2-enylpiperidine-3-carboxamide (PubChem CID 42869827) has the molecular formula C25H31FN2O2 and a molecular weight of 410.53 g/mol. Its IUPAC name is 5-(4-fluoro-3-methylphenyl)-N-[2-(2-methoxyphenyl)ethyl]-1-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | 5-(4-fluoro-3-methylphenyl)-N-[2-(2-methoxyphenyl)ethyl]-1-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42869827 |
| Molecular Formula | C25H31FN2O2 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 5-(4-fluoro-3-methylphenyl)-N-[2-(2-methoxyphenyl)ethyl]-1-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCN1CC(C(=O)NCCc2ccccc2OC)CC(c2ccc(F)c(C)c2)C1 |
| InChI | InChI=1S/C25H31FN2O2/c1-4-13-28-16-21(20-9-10-23(26)18(2)14-20)15-22(17-28)25(29)27-12-11-19-7-5-6-8-24(19)30-3/h4-10,14,21-22H,1,11-13,15-17H2,2-3H3,(H,27,29) |
| InChIKey | FDKOTPAAMBIPPC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|