C25H32FN3O3 — CID 92997182
(3R,5R)-1-N-butyl-5-(4-fluoro-3-methylphenyl)-3-N-(4-methoxyphenyl)piperidine-1,3-dicarboxamide (PubChem CID 92997182) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is (3R,5R)-1-N-butyl-5-(4-fluoro-3-methylphenyl)-3-N-(4-methoxyphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R,5R)-1-N-butyl-5-(4-fluoro-3-methylphenyl)-3-N-(4-methoxyphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 92997182 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (3R,5R)-1-N-butyl-5-(4-fluoro-3-methylphenyl)-3-N-(4-methoxyphenyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1C[C@H](C(=O)Nc2ccc(OC)cc2)C[C@H](c2ccc(F)c(C)c2)C1 |
| InChI | InChI=1S/C25H32FN3O3/c1-4-5-12-27-25(31)29-15-19(18-6-11-23(26)17(2)13-18)14-20(16-29)24(30)28-21-7-9-22(32-3)10-8-21/h6-11,13,19-20H,4-5,12,14-16H2,1-3H3,(H,27,31)(H,28,30)/t19-,20+/m0/s1 |
| InChIKey | UJZKTZPAQRBUCU-VQTJNVASSA-N |
| XLogP | 4.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|