C27H33N3O4 — CID 42869320
N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-(2-phenoxyacetyl)-5-phenylpiperidine-3-carboxamide (PubChem CID 42869320) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-(2-phenoxyacetyl)-5-phenylpiperidine-3-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-(2-phenoxyacetyl)-5-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42869320 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-(2-phenoxyacetyl)-5-phenylpiperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)C1CC(c2ccccc2)CN(C(=O)COc2ccccc2)C1 |
| InChI | InChI=1S/C27H33N3O4/c31-25-13-7-15-29(25)16-8-14-28-27(33)23-17-22(21-9-3-1-4-10-21)18-30(19-23)26(32)20-34-24-11-5-2-6-12-24/h1-6,9-12,22-23H,7-8,13-20H2,(H,28,33) |
| InChIKey | IRYVYHWUVHYERY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|