C28H34FN3O3 — CID 42869336
5-(4-fluoro-3-methylphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 42869336) has the molecular formula C28H34FN3O3 and a molecular weight of 479.60 g/mol. Its IUPAC name is 5-(4-fluoro-3-methylphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | 5-(4-fluoro-3-methylphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42869336 |
| Molecular Formula | C28H34FN3O3 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 5-(4-fluoro-3-methylphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C2CC(C(=O)NCCCN3CCCC3=O)CN(C(=O)Cc3ccccc3)C2)ccc1F |
| InChI | InChI=1S/C28H34FN3O3/c1-20-15-22(10-11-25(20)29)23-17-24(28(35)30-12-6-14-31-13-5-9-26(31)33)19-32(18-23)27(34)16-21-7-3-2-4-8-21/h2-4,7-8,10-11,15,23-24H,5-6,9,12-14,16-19H2,1H3,(H,30,35) |
| InChIKey | XHWYOCZRXKRVMO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|