C17H24N2O5 — CID 42865225
5-(3,4-dimethoxyphenyl)-1-(ethylcarbamoyl)piperidine-3-carboxylic acid (PubChem CID 42865225) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-1-(ethylcarbamoyl)piperidine-3-carboxylic acid.
| Compound Name | 5-(3,4-dimethoxyphenyl)-1-(ethylcarbamoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 42865225 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-1-(ethylcarbamoyl)piperidine-3-carboxylic acid |
| SMILES | CCNC(=O)N1CC(C(=O)O)CC(c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C17H24N2O5/c1-4-18-17(22)19-9-12(7-13(10-19)16(20)21)11-5-6-14(23-2)15(8-11)24-3/h5-6,8,12-13H,4,7,9-10H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | SCRSMWCZZKIZMO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |