C23H26N6O — CID 67542890
2-[benzyl-(9-benzyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl)amino]ethanol (PubChem CID 67542890) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[benzyl-(9-benzyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl)amino]ethanol.
| Compound Name | 2-[benzyl-(9-benzyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl)amino]ethanol |
|---|---|
| PubChem CID | 67542890 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[benzyl-(9-benzyl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-yl)amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)c1nc2c3c(n1)N(Cc1ccccc1)CCC3NN2 |
| InChI | InChI=1S/C23H26N6O/c30-14-13-29(16-18-9-5-2-6-10-18)23-24-21-20-19(26-27-21)11-12-28(22(20)25-23)15-17-7-3-1-4-8-17/h1-10,19,26,30H,11-16H2,(H,24,25,27) |
| InChIKey | XRUKBPVJNHDCCR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |