C23H22N6O — CID 123768390
2-[benzyl-(8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-11-yl)amino]ethanol (PubChem CID 123768390) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-[benzyl-(8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-11-yl)amino]ethanol.
| Compound Name | 2-[benzyl-(8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-11-yl)amino]ethanol |
|---|---|
| PubChem CID | 123768390 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-[benzyl-(8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-11-yl)amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)c1ncc2c(n1)N(c1ccccc1)Cc1cn[nH]c1-2 |
| InChI | InChI=1S/C23H22N6O/c30-12-11-28(15-17-7-3-1-4-8-17)23-24-14-20-21-18(13-25-27-21)16-29(22(20)26-23)19-9-5-2-6-10-19/h1-10,13-14,30H,11-12,15-16H2,(H,25,27) |
| InChIKey | HKHMBIKBIMZULC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |