C21H29N7O — CID 67545406
9-benzyl-N-(3-morpholin-4-ylpropyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine (PubChem CID 67545406) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is 9-benzyl-N-(3-morpholin-4-ylpropyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine.
| Compound Name | 9-benzyl-N-(3-morpholin-4-ylpropyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine |
|---|---|
| PubChem CID | 67545406 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 9-benzyl-N-(3-morpholin-4-ylpropyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-6-amine |
| SMILES | c1ccc(CN2CCC3NNc4nc(NCCCN5CCOCC5)nc2c43)cc1 |
| InChI | InChI=1S/C21H29N7O/c1-2-5-16(6-3-1)15-28-10-7-17-18-19(26-25-17)23-21(24-20(18)28)22-8-4-9-27-11-13-29-14-12-27/h1-3,5-6,17,25H,4,7-15H2,(H2,22,23,24,26) |
| InChIKey | HCMXONGFUGESBT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|