C18H30N8O — CID 50795405
1-methyl-4-(4-methylpiperazin-1-yl)-N-(3-morpholin-4-ylpropyl)pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 50795405) has the molecular formula C18H30N8O and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-methyl-4-(4-methylpiperazin-1-yl)-N-(3-morpholin-4-ylpropyl)pyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 1-methyl-4-(4-methylpiperazin-1-yl)-N-(3-morpholin-4-ylpropyl)pyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 50795405 |
| Molecular Formula | C18H30N8O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 1-methyl-4-(4-methylpiperazin-1-yl)-N-(3-morpholin-4-ylpropyl)pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | CN1CCN(c2nc(NCCCN3CCOCC3)nc3c2cnn3C)CC1 |
| InChI | InChI=1S/C18H30N8O/c1-23-6-8-26(9-7-23)17-15-14-20-24(2)16(15)21-18(22-17)19-4-3-5-25-10-12-27-13-11-25/h14H,3-13H2,1-2H3,(H,19,21,22) |
| InChIKey | GGRGWWYJQCFHAO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|