C19H24ClN7O — CID 20959289
4-N-(3-chlorophenyl)-1-methyl-6-N-(3-morpholin-4-ylpropyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 20959289) has the molecular formula C19H24ClN7O and a molecular weight of 401.90 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-1-methyl-6-N-(3-morpholin-4-ylpropyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-1-methyl-6-N-(3-morpholin-4-ylpropyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 20959289 |
| Molecular Formula | C19H24ClN7O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-N-(3-chlorophenyl)-1-methyl-6-N-(3-morpholin-4-ylpropyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | Cn1ncc2c(Nc3cccc(Cl)c3)nc(NCCCN3CCOCC3)nc21 |
| InChI | InChI=1S/C19H24ClN7O/c1-26-18-16(13-22-26)17(23-15-5-2-4-14(20)12-15)24-19(25-18)21-6-3-7-27-8-10-28-11-9-27/h2,4-5,12-13H,3,6-11H2,1H3,(H2,21,23,24,25) |
| InChIKey | JISDOJXWRHGKHM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|