C17H24ClN7O2 — CID 134108440
N-[4-[(3-chlorophenyl)methylamino]-6-(3-morpholin-4-ylpropylamino)-1,3,5-triazin-2-yl]hydroxylamine (PubChem CID 134108440) has the molecular formula C17H24ClN7O2 and a molecular weight of 393.88 g/mol. Its IUPAC name is N-[4-[(3-chlorophenyl)methylamino]-6-(3-morpholin-4-ylpropylamino)-1,3,5-triazin-2-yl]hydroxylamine.
| Compound Name | N-[4-[(3-chlorophenyl)methylamino]-6-(3-morpholin-4-ylpropylamino)-1,3,5-triazin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 134108440 |
| Molecular Formula | C17H24ClN7O2 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[4-[(3-chlorophenyl)methylamino]-6-(3-morpholin-4-ylpropylamino)-1,3,5-triazin-2-yl]hydroxylamine |
| SMILES | ONc1nc(NCCCN2CCOCC2)nc(NCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H24ClN7O2/c18-14-4-1-3-13(11-14)12-20-16-21-15(22-17(23-16)24-26)19-5-2-6-25-7-9-27-10-8-25/h1,3-4,11,26H,2,5-10,12H2,(H3,19,20,21,22,23,24) |
| InChIKey | DOYAMEZSPVZTTQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|