C17H27N7O2 — CID 46345391
1-methyl-4-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 46345391) has the molecular formula C17H27N7O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-methyl-4-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 1-methyl-4-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 46345391 |
| Molecular Formula | C17H27N7O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-methyl-4-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | Cn1ncc2c(N3CCOCC3)nc(NCCCN3CCOCC3)nc21 |
| InChI | InChI=1S/C17H27N7O2/c1-22-15-14(13-19-22)16(24-7-11-26-12-8-24)21-17(20-15)18-3-2-4-23-5-9-25-10-6-23/h13H,2-12H2,1H3,(H,18,20,21) |
| InChIKey | QXPFUKAUCUIQNO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|