C21H27N7O — CID 59506573
9-benzyl-N-(3-morpholin-4-ylpropyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine (PubChem CID 59506573) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 9-benzyl-N-(3-morpholin-4-ylpropyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine.
| Compound Name | 9-benzyl-N-(3-morpholin-4-ylpropyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 59506573 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 9-benzyl-N-(3-morpholin-4-ylpropyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
| SMILES | c1ccc(CN2CCc3[nH]nc4nc(NCCCN5CCOCC5)nc2c34)cc1 |
| InChI | InChI=1S/C21H27N7O/c1-2-5-16(6-3-1)15-28-10-7-17-18-19(26-25-17)23-21(24-20(18)28)22-8-4-9-27-11-13-29-14-12-27/h1-3,5-6H,4,7-15H2,(H2,22,23,24,25,26) |
| InChIKey | YYXZVBWDONYDLX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|