C21H28N6O — CID 67544169
9-[(4-methoxyphenyl)methyl]-3-methyl-6-piperidin-1-yl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene (PubChem CID 67544169) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is 9-[(4-methoxyphenyl)methyl]-3-methyl-6-piperidin-1-yl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene.
| Compound Name | 9-[(4-methoxyphenyl)methyl]-3-methyl-6-piperidin-1-yl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene |
|---|---|
| PubChem CID | 67544169 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 9-[(4-methoxyphenyl)methyl]-3-methyl-6-piperidin-1-yl-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene |
| SMILES | COc1ccc(CN2CCC3NN(C)c4nc(N5CCCCC5)nc2c43)cc1 |
| InChI | InChI=1S/C21H28N6O/c1-25-19-18-17(24-25)10-13-27(14-15-6-8-16(28-2)9-7-15)20(18)23-21(22-19)26-11-4-3-5-12-26/h6-9,17,24H,3-5,10-14H2,1-2H3 |
| InChIKey | KHCDTXXXOYSBNM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |