C11H15NOS — CID 101352609
2-[(4-methoxyphenyl)methyl]-1,2-thiazolidine (PubChem CID 101352609) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-1,2-thiazolidine.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-1,2-thiazolidine |
|---|---|
| PubChem CID | 101352609 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-1,2-thiazolidine |
| SMILES | COc1ccc(CN2CCCS2)cc1 |
| InChI | InChI=1S/C11H15NOS/c1-13-11-5-3-10(4-6-11)9-12-7-2-8-14-12/h3-6H,2,7-9H2,1H3 |
| InChIKey | ZHHFOMOYOXQISN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|