C18H25N5O — CID 143533585
4-[3-(4-methoxyphenyl)propyl]-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 143533585) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)propyl]-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-[3-(4-methoxyphenyl)propyl]-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 143533585 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)propyl]-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(CCCc2nc(N)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C18H25N5O/c1-24-15-10-8-14(9-11-15)6-5-7-16-20-17(19)22-18(21-16)23-12-3-2-4-13-23/h8-11H,2-7,12-13H2,1H3,(H2,19,20,21,22) |
| InChIKey | JFXCDNRVXHCSBB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |