C23H29N5O2 — CID 166072352
(8S)-6-benzyl-8-ethenyl-2-morpholin-4-yl-9-propyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one (PubChem CID 166072352) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (8S)-6-benzyl-8-ethenyl-2-morpholin-4-yl-9-propyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one.
| Compound Name | (8S)-6-benzyl-8-ethenyl-2-morpholin-4-yl-9-propyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 166072352 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (8S)-6-benzyl-8-ethenyl-2-morpholin-4-yl-9-propyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one |
| SMILES | C=C[C@H]1CN(Cc2ccccc2)C(=O)c2cnc(N3CCOCC3)nc2N1CCC |
| InChI | InChI=1S/C23H29N5O2/c1-3-10-28-19(4-2)17-27(16-18-8-6-5-7-9-18)22(29)20-15-24-23(25-21(20)28)26-11-13-30-14-12-26/h4-9,15,19H,2-3,10-14,16-17H2,1H3/t19-/m0/s1 |
| InChIKey | QFZJOIQXQHLDQU-IBGZPJMESA-N |
| XLogP | 2.74 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|