C18H15N3 — CID 135273812
2-cyclopropyl-4,6-diphenyl-1,3,5-triazine (PubChem CID 135273812) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-cyclopropyl-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-cyclopropyl-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 135273812 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-cyclopropyl-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(C3CC3)n2)cc1 |
| InChI | InChI=1S/C18H15N3/c1-3-7-13(8-4-1)16-19-17(14-9-5-2-6-10-14)21-18(20-16)15-11-12-15/h1-10,15H,11-12H2 |
| InChIKey | CWGLXFBDJAMAHC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |