C39H47N9 — CID 176842869
2-cyclohexyl-4-[4-[4-[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-6-propan-2-yl-1,3,5-triazin-2-yl]phenyl]-6-propan-2-yl-1,3,5-triazine (PubChem CID 176842869) has the molecular formula C39H47N9 and a molecular weight of 641.87 g/mol. Its IUPAC name is 2-cyclohexyl-4-[4-[4-[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-6-propan-2-yl-1,3,5-triazin-2-yl]phenyl]-6-propan-2-yl-1,3,5-triazine.
| Compound Name | 2-cyclohexyl-4-[4-[4-[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-6-propan-2-yl-1,3,5-triazin-2-yl]phenyl]-6-propan-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 176842869 |
| Molecular Formula | C39H47N9 |
| Molecular Weight | 641.87 g/mol |
| Exact Mass | 641.40 |
| IUPAC Name | 2-cyclohexyl-4-[4-[4-[3-[4,6-di(propan-2-yl)-1,3,5-triazin-2-yl]phenyl]-6-propan-2-yl-1,3,5-triazin-2-yl]phenyl]-6-propan-2-yl-1,3,5-triazine |
| SMILES | CC(C)c1nc(-c2ccc(-c3nc(C(C)C)nc(C4CCCCC4)n3)cc2)nc(-c2cccc(-c3nc(C(C)C)nc(C(C)C)n3)c2)n1 |
| InChI | InChI=1S/C39H47N9/c1-22(2)31-40-32(23(3)4)45-38(44-31)29-15-12-16-30(21-29)39-46-34(25(7)8)43-37(48-39)28-19-17-27(18-20-28)36-42-33(24(5)6)41-35(47-36)26-13-10-9-11-14-26/h12,15-26H,9-11,13-14H2,1-8H3 |
| InChIKey | WRRODEYIQFQJPD-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.87 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |