C13H14N4O2S — CID 115337607
4-(1,1-dioxothiolan-3-yl)-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 115337607) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115337607 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)nc(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C13H14N4O2S/c14-13-16-11(9-4-2-1-3-5-9)15-12(17-13)10-6-7-20(18,19)8-10/h1-5,10H,6-8H2,(H2,14,15,16,17) |
| InChIKey | YVVVWLKJEMUYJW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |