C12H11FN4 — CID 63868480
4-cyclopropyl-6-(3-fluorophenyl)-1,3,5-triazin-2-amine (PubChem CID 63868480) has the molecular formula C12H11FN4 and a molecular weight of 230.25 g/mol. Its IUPAC name is 4-cyclopropyl-6-(3-fluorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclopropyl-6-(3-fluorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63868480 |
| Molecular Formula | C12H11FN4 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 4-cyclopropyl-6-(3-fluorophenyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2cccc(F)c2)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H11FN4/c13-9-3-1-2-8(6-9)11-15-10(7-4-5-7)16-12(14)17-11/h1-3,6-7H,4-5H2,(H2,14,15,16,17) |
| InChIKey | CHRMMJFQZNFAQY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |