C15H17FN4O — CID 107923218
4-cyclopentyl-6-(4-fluoro-3-methoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 107923218) has the molecular formula C15H17FN4O and a molecular weight of 288.33 g/mol. Its IUPAC name is 4-cyclopentyl-6-(4-fluoro-3-methoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclopentyl-6-(4-fluoro-3-methoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 107923218 |
| Molecular Formula | C15H17FN4O |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-cyclopentyl-6-(4-fluoro-3-methoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(-c2nc(N)nc(C3CCCC3)n2)ccc1F |
| InChI | InChI=1S/C15H17FN4O/c1-21-12-8-10(6-7-11(12)16)14-18-13(19-15(17)20-14)9-4-2-3-5-9/h6-9H,2-5H2,1H3,(H2,17,18,19,20) |
| InChIKey | DJXMWJYGANPTGR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |