C23H29N7O3 — CID 174589664
2-[4-[6-(4-aminophenyl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-1-yl]piperidin-1-yl]ethyl formate (PubChem CID 174589664) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-[4-[6-(4-aminophenyl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-1-yl]piperidin-1-yl]ethyl formate.
| Compound Name | 2-[4-[6-(4-aminophenyl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-1-yl]piperidin-1-yl]ethyl formate |
|---|---|
| PubChem CID | 174589664 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-[4-[6-(4-aminophenyl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-1-yl]piperidin-1-yl]ethyl formate |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)c3cnn(C4CCN(CCOC=O)CC4)c3n2)cc1 |
| InChI | InChI=1S/C23H29N7O3/c24-18-3-1-17(2-4-18)21-26-22(29-10-13-32-14-11-29)20-15-25-30(23(20)27-21)19-5-7-28(8-6-19)9-12-33-16-31/h1-4,15-16,19H,5-14,24H2 |
| InChIKey | PTDKFPVKTCOHCE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|