C31H38N8O3 — CID 25195789
1-[4-[1-(1-benzylpiperidin-4-yl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl]phenyl]-3-(2-methoxyethyl)urea (PubChem CID 25195789) has the molecular formula C31H38N8O3 and a molecular weight of 570.70 g/mol. Its IUPAC name is 1-[4-[1-(1-benzylpiperidin-4-yl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl]phenyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[4-[1-(1-benzylpiperidin-4-yl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl]phenyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 25195789 |
| Molecular Formula | C31H38N8O3 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 1-[4-[1-(1-benzylpiperidin-4-yl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl]phenyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1ccc(-c2nc(N3CCOCC3)c3cnn(C4CCN(Cc5ccccc5)CC4)c3n2)cc1 |
| InChI | InChI=1S/C31H38N8O3/c1-41-18-13-32-31(40)34-25-9-7-24(8-10-25)28-35-29(38-16-19-42-20-17-38)27-21-33-39(30(27)36-28)26-11-14-37(15-12-26)22-23-5-3-2-4-6-23/h2-10,21,26H,11-20,22H2,1H3,(H2,32,34,40) |
| InChIKey | VTPBQPROVPRKLB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|