C30H37N9O2 — CID 68865981
1-[4-[1-(1-benzylpiperidin-4-yl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl]phenyl]-1-(dimethylamino)urea (PubChem CID 68865981) has the molecular formula C30H37N9O2 and a molecular weight of 555.69 g/mol. Its IUPAC name is 1-[4-[1-(1-benzylpiperidin-4-yl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl]phenyl]-1-(dimethylamino)urea.
| Compound Name | 1-[4-[1-(1-benzylpiperidin-4-yl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl]phenyl]-1-(dimethylamino)urea |
|---|---|
| PubChem CID | 68865981 |
| Molecular Formula | C30H37N9O2 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | 1-[4-[1-(1-benzylpiperidin-4-yl)-4-morpholin-4-ylpyrazolo[5,4-d]pyrimidin-6-yl]phenyl]-1-(dimethylamino)urea |
| SMILES | CN(C)N(C(N)=O)c1ccc(-c2nc(N3CCOCC3)c3cnn(C4CCN(Cc5ccccc5)CC4)c3n2)cc1 |
| InChI | InChI=1S/C30H37N9O2/c1-35(2)39(30(31)40)25-10-8-23(9-11-25)27-33-28(37-16-18-41-19-17-37)26-20-32-38(29(26)34-27)24-12-14-36(15-13-24)21-22-6-4-3-5-7-22/h3-11,20,24H,12-19,21H2,1-2H3,(H2,31,40) |
| InChIKey | OQOXZCHACPGJCT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|