C21H26N5O3S2+ — CID 143633333
[1-[[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]carbamoyl]pyrrolidin-3-yl]-oxosulfanium (PubChem CID 143633333) has the molecular formula C21H26N5O3S2+ and a molecular weight of 460.61 g/mol. Its IUPAC name is [1-[[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]carbamoyl]pyrrolidin-3-yl]-oxosulfanium.
| Compound Name | [1-[[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]carbamoyl]pyrrolidin-3-yl]-oxosulfanium |
|---|---|
| PubChem CID | 143633333 |
| Molecular Formula | C21H26N5O3S2+ |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [1-[[4-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]carbamoyl]pyrrolidin-3-yl]-oxosulfanium |
| SMILES | CSCc1cc(N2CCOCC2)nc(-c2ccc(NC(=O)N3CCC([S+]=O)C3)cc2)n1 |
| InChI | InChI=1S/C21H25N5O3S2/c1-30-14-17-12-19(25-8-10-29-11-9-25)24-20(22-17)15-2-4-16(5-3-15)23-21(27)26-7-6-18(13-26)31-28/h2-5,12,18H,6-11,13-14H2,1H3/p+1 |
| InChIKey | ONSKVFGNQPQBQY-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|