C18H23N5O2S — CID 143504256
2-[2-amino-5-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-2-iminoethanol (PubChem CID 143504256) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-[2-amino-5-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-2-iminoethanol.
| Compound Name | 2-[2-amino-5-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-2-iminoethanol |
|---|---|
| PubChem CID | 143504256 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[2-amino-5-[4-(methylsulfanylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-2-iminoethanol |
| SMILES | [H]/N=C(\CO)c1cc(-c2nc(CSC)cc(N3CCOCC3)n2)ccc1N |
| InChI | InChI=1S/C18H23N5O2S/c1-26-11-13-9-17(23-4-6-25-7-5-23)22-18(21-13)12-2-3-15(19)14(8-12)16(20)10-24/h2-3,8-9,20,24H,4-7,10-11,19H2,1H3/b20-16+ |
| InChIKey | NEBDFURSQSGWAR-CAPFRKAQSA-N |
| XLogP | 1.79 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|