C17H23N7O2 — CID 137467848
5-(2-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonin-4-yl)pyrimidin-2-amine (PubChem CID 137467848) has the molecular formula C17H23N7O2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 5-(2-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonin-4-yl)pyrimidin-2-amine.
| Compound Name | 5-(2-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonin-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 137467848 |
| Molecular Formula | C17H23N7O2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 5-(2-morpholin-4-yl-5,6,7,9,10,11-hexahydropyrimido[4,5-e][1,4]oxazonin-4-yl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)nc3c2CCCOCCN3)cn1 |
| InChI | InChI=1S/C17H23N7O2/c18-16-20-10-12(11-21-16)14-13-2-1-6-25-7-3-19-15(13)23-17(22-14)24-4-8-26-9-5-24/h10-11H,1-9H2,(H2,18,20,21)(H,19,22,23) |
| InChIKey | LOHOKVIUFZPBBI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |