C11H16N2O — CID 135214290
4-(3,6-dimethyl-2-pyridinyl)morpholine (PubChem CID 135214290) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(3,6-dimethyl-2-pyridinyl)morpholine.
| Compound Name | 4-(3,6-dimethyl-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 135214290 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 4-(3,6-dimethyl-2-pyridinyl)morpholine |
| SMILES | Cc1ccc(C)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H16N2O/c1-9-3-4-10(2)12-11(9)13-5-7-14-8-6-13/h3-4H,5-8H2,1-2H3 |
| InChIKey | DNGYEZUMHFLEOV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |