C11H12BN3O2 — CID 166164666
CID 166164666 (PubChem CID 166164666) has the molecular formula C11H12BN3O2 and a molecular weight of 229.05 g/mol.
| Compound Name | CID 166164666 |
|---|---|
| PubChem CID | 166164666 |
| Molecular Formula | C11H12BN3O2 |
| Molecular Weight | 229.05 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | — |
| SMILES | [B]c1cc2nc(C)nc(N3CCOCC3)c2o1 |
| InChI | InChI=1S/C11H12BN3O2/c1-7-13-8-6-9(12)17-10(8)11(14-7)15-2-4-16-5-3-15/h6H,2-5H2,1H3 |
| InChIKey | NYIGUGOWZHPOFX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.05 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|