C19H23N3O2 — CID 166164967
2-methyl-4-morpholin-4-yl-6-[(3E,5Z)-octa-3,5,7-trien-3-yl]furo[3,2-d]pyrimidine (PubChem CID 166164967) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-methyl-4-morpholin-4-yl-6-[(3E,5Z)-octa-3,5,7-trien-3-yl]furo[3,2-d]pyrimidine.
| Compound Name | 2-methyl-4-morpholin-4-yl-6-[(3E,5Z)-octa-3,5,7-trien-3-yl]furo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 166164967 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-methyl-4-morpholin-4-yl-6-[(3E,5Z)-octa-3,5,7-trien-3-yl]furo[3,2-d]pyrimidine |
| SMILES | C=C/C=C\C=C(/CC)c1cc2nc(C)nc(N3CCOCC3)c2o1 |
| InChI | InChI=1S/C19H23N3O2/c1-4-6-7-8-15(5-2)17-13-16-18(24-17)19(21-14(3)20-16)22-9-11-23-12-10-22/h4,6-8,13H,1,5,9-12H2,2-3H3/b7-6-,15-8+ |
| InChIKey | YFHCIYXMSJZCEA-WLYYOSHGSA-N |
| XLogP | 3.90 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|