C33H41N5O2 — CID 166164391
2-methyl-N'-[4-morpholin-4-yl-6-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]furo[3,2-d]pyrimidin-2-yl]-N-[(Z)-1-phenylprop-1-enyl]butanimidamide (PubChem CID 166164391) has the molecular formula C33H41N5O2 and a molecular weight of 539.72 g/mol. Its IUPAC name is 2-methyl-N'-[4-morpholin-4-yl-6-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]furo[3,2-d]pyrimidin-2-yl]-N-[(Z)-1-phenylprop-1-enyl]butanimidamide.
| Compound Name | 2-methyl-N'-[4-morpholin-4-yl-6-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]furo[3,2-d]pyrimidin-2-yl]-N-[(Z)-1-phenylprop-1-enyl]butanimidamide |
|---|---|
| PubChem CID | 166164391 |
| Molecular Formula | C33H41N5O2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.33 |
| IUPAC Name | 2-methyl-N'-[4-morpholin-4-yl-6-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]furo[3,2-d]pyrimidin-2-yl]-N-[(Z)-1-phenylprop-1-enyl]butanimidamide |
| SMILES | C/C=C\C(=C/C=C/CC)c1cc2nc(/N=C(/N/C(=C\C)c3ccccc3)C(C)CC)nc(N3CCOCC3)c2o1 |
| InChI | InChI=1S/C33H41N5O2/c1-6-10-12-18-26(15-7-2)29-23-28-30(40-29)32(38-19-21-39-22-20-38)37-33(35-28)36-31(24(5)8-3)34-27(9-4)25-16-13-11-14-17-25/h7,9-18,23-24H,6,8,19-22H2,1-5H3,(H,34,35,36,37)/b12-10+,15-7-,26-18+,27-9- |
| InChIKey | BGWJNDDKYYKLOA-BDPQPOROSA-N |
| XLogP | 7.71 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|