C28H29N5O3 — CID 166164854
4-morpholin-4-yl-6-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-N-(4-phenyl-1,3-oxazol-2-yl)furo[3,2-d]pyrimidin-2-amine (PubChem CID 166164854) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-N-(4-phenyl-1,3-oxazol-2-yl)furo[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-morpholin-4-yl-6-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-N-(4-phenyl-1,3-oxazol-2-yl)furo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166164854 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-morpholin-4-yl-6-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-N-(4-phenyl-1,3-oxazol-2-yl)furo[3,2-d]pyrimidin-2-amine |
| SMILES | C/C=C\C(=C/C=C/CC)c1cc2nc(Nc3nc(-c4ccccc4)co3)nc(N3CCOCC3)c2o1 |
| InChI | InChI=1S/C28H29N5O3/c1-3-5-7-13-21(10-4-2)24-18-22-25(36-24)26(33-14-16-34-17-15-33)31-27(29-22)32-28-30-23(19-35-28)20-11-8-6-9-12-20/h4-13,18-19H,3,14-17H2,1-2H3,(H,29,30,31,32)/b7-5+,10-4-,21-13+ |
| InChIKey | CAVGSUKYZCISTN-WEIYLOFASA-N |
| XLogP | 6.38 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|