C20H26N4O — CID 168921751
4-[5-methyl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-7-yl]morpholine (PubChem CID 168921751) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 4-[5-methyl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-7-yl]morpholine.
| Compound Name | 4-[5-methyl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-7-yl]morpholine |
|---|---|
| PubChem CID | 168921751 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-[5-methyl-2-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]pyrazolo[1,5-a]pyrimidin-7-yl]morpholine |
| SMILES | C/C=C\C(=C/C=C/CC)c1cc2nc(C)cc(N3CCOCC3)n2n1 |
| InChI | InChI=1S/C20H26N4O/c1-4-6-7-9-17(8-5-2)18-15-19-21-16(3)14-20(24(19)22-18)23-10-12-25-13-11-23/h5-9,14-15H,4,10-13H2,1-3H3/b7-6+,8-5-,17-9+ |
| InChIKey | APSCAXJZWBTPCT-MSOYJSDNSA-N |
| XLogP | 3.80 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|